Products 68215-44-1

CAS 68215-44-1 is the registry number for 2-Amino-1-(4-nitrophenyl)ethanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.

Structural formula: {0} (CAS {1})

2-amino-1-(4-nitrophenyl)ethanol;hydrochloride (CAS 68215-44-1) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-amino-1-(4-nitrophenyl)ethanol;hydrochloride. InChIKey: DEXQHYFOYNPWIM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClN2O3
Molecular weight218.64 g/mol
IUPAC name2-amino-1-(4-nitrophenyl)ethanol;hydrochloride
InChIKeyDEXQHYFOYNPWIM-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(CN)O)[N+](=O)[O-].Cl

Computed by PubChem (NCBI)