CAS 68215-44-1 is the registry number for 2-Amino-1-(4-nitrophenyl)ethanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
2-amino-1-(4-nitrophenyl)ethanol;hydrochloride (CAS 68215-44-1) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-amino-1-(4-nitrophenyl)ethanol;hydrochloride. InChIKey: DEXQHYFOYNPWIM-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-amino-1-(4-nitrophenyl)ethanol;hydrochloride |
| InChIKey | DEXQHYFOYNPWIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CN)O)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)