Products 1179377-17-3

CAS 1179377-17-3 is the registry number for 2-(4,6-Dimethyl-2-oxo-1,2-dihydropyrimidin-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride (CAS 1179377-17-3) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride. InChIKey: RBQZRNSVTXATNR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClN2O3
Molecular weight218.64 g/mol
IUPAC name2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride
InChIKeyRBQZRNSVTXATNR-UHFFFAOYSA-N
SMILESCC1=CC(=NC(=O)N1CC(=O)O)C.Cl

Computed by PubChem (NCBI)