CAS 1179377-17-3 is the registry number for 2-(4,6-Dimethyl-2-oxo-1,2-dihydropyrimidin-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride (CAS 1179377-17-3) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride. InChIKey: RBQZRNSVTXATNR-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride |
| InChIKey | RBQZRNSVTXATNR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=O)N1CC(=O)O)C.Cl |
Computed by PubChem (NCBI)