cas: 53086-53-6 — see every product listed under this CAS number, including other names
2-(4-bromophenyl)propanoic acid, 95% (CAS 53086-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F521323-100MG |
| cas | 53086-53-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 500mg | 815.36 Pln | |
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 2.5g | 2262.76 Pln | |
| Fluorochem | 5g | 3121.84 Pln | |
| Fluorochem | 10g | 4912.87 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromophenyl)propanoic acid (CAS 53086-53-6) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(4-bromophenyl)propanoic acid. InChIKey: PFDBEACWLCHWRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(4-bromophenyl)propanoic acid |
| InChIKey | PFDBEACWLCHWRZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)