CAS 156143-00-9 appears in our catalog under these names: (S)-2-(4-Bromophenyl)propanoic acid, 98%, (S)–2–(4–Bromophenyl)propanoic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(2S)-2-(4-bromophenyl)propanoic acid (CAS 156143-00-9) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (2S)-2-(4-bromophenyl)propanoic acid. InChIKey: PFDBEACWLCHWRZ-LURJTMIESA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (2S)-2-(4-bromophenyl)propanoic acid |
| InChIKey | PFDBEACWLCHWRZ-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)