cas: 214360-47-1 — see every product listed under this CAS number, including other names
2-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile, 98% (CAS 214360-47-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218967-5G |
| cas | 214360-47-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 357.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile (CAS 214360-47-1) is a chemical compound with the molecular formula C12H14BNO2 and a molecular weight of 215.06 g/mol. IUPAC name: 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile. InChIKey: QHAYLPAKZXKQSE-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO2 |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
| InChIKey | QHAYLPAKZXKQSE-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)