CAS 2377610-97-2 appears in our catalog under these names: [4-(1-Cyanocyclopentyl)phenyl]boronic acid, 95%, [4-(1-Cyanocyclopentyl)phenyl]boronic acid 95%, [4-(1-Cyanocyclopentyl)phenyl]boronic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg.
[4-(1-cyanocyclopentyl)phenyl]boronic acid (CAS 2377610-97-2) is a chemical compound with the molecular formula C12H14BNO2 and a molecular weight of 215.06 g/mol. IUPAC name: [4-(1-cyanocyclopentyl)phenyl]boronic acid. InChIKey: ZNINYILPLNZOEJ-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO2 |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | [4-(1-cyanocyclopentyl)phenyl]boronic acid |
| InChIKey | ZNINYILPLNZOEJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CCCC2)C#N)(O)O |
Computed by PubChem (NCBI)