Products 636987-06-9
CAS 636987-06-9 is the registry number for (4-(Dimethylamino)naphthalen-1-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(dimethylamino)naphthalen-1-yl]boronic acid (CAS 636987-06-9) is a chemical compound with the molecular formula C12H14BNO2 and a molecular weight of 215.06 g/mol. IUPAC name: [4-(dimethylamino)naphthalen-1-yl]boronic acid. InChIKey: VARHCYCAOVDXOA-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO2 |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | [4-(dimethylamino)naphthalen-1-yl]boronic acid |
| InChIKey | VARHCYCAOVDXOA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)N(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
B-[4-(Dimethylamino)-1-naphthalenyl]boronic acid, B-(4-(Dimethylamino)-1-naphthalenyl)boronic acid, (4-(Dimethylamino)naphthalen-1-yl)boronic acid, [4-(dimethylamino)naphthalen-1-yl]boronic acid, 4-(Dimethylamino)-1-naphthaleneboronic Acid, [4-(dimethylamino)naphthyl]boronic acid, Boronic acid, B-[4-(dimethylamino)-1-naphthalenyl]-