cas: 52055-23-9 — see every product listed under this CAS number, including other names
2-(5-(Benzyloxy)-1H-indol-3-yl)ethan-1-amine hydrochloride, 98%, 98% (CAS 52055-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MF8-250mg |
| cas | 52055-23-9 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1245.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(5-phenylmethoxy-1H-indol-3-yl)ethanamine;hydrochloride (CAS 52055-23-9) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: 2-(5-phenylmethoxy-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: IUWVJCIEWSQGHH-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 2-(5-phenylmethoxy-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | IUWVJCIEWSQGHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3CCN.Cl |
Computed by PubChem (NCBI)