Products 1982608-63-8
CAS 1982608-63-8 is the registry number for [4-(5-Isopropyl-1,3-benzoxazol-2-yl)benzyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methanamine;hydrochloride (CAS 1982608-63-8) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: [4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methanamine;hydrochloride. InChIKey: WLRJMTPTEGFJNO-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | [4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methanamine;hydrochloride |
| InChIKey | WLRJMTPTEGFJNO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(C=C3)CN.Cl |
Computed by PubChem (NCBI)