Products 1049763-60-1

CAS 1049763-60-1 is the registry number for 2-(2-Methyl-5-phenoxy-1h-indol-3-yl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, on request.

Structural formula: {0} (CAS {1})

2-(2-methyl-5-phenoxy-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1049763-60-1) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: 2-(2-methyl-5-phenoxy-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: LFDCUPPILQFYAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19ClN2O
Molecular weight302.8 g/mol
IUPAC name2-(2-methyl-5-phenoxy-1H-indol-3-yl)ethanamine;hydrochloride
InChIKeyLFDCUPPILQFYAJ-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1)C=CC(=C2)OC3=CC=CC=C3)CCN.Cl

Computed by PubChem (NCBI)