CAS 1049763-60-1 is the registry number for 2-(2-Methyl-5-phenoxy-1h-indol-3-yl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, on request.
2-(2-methyl-5-phenoxy-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1049763-60-1) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: 2-(2-methyl-5-phenoxy-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: LFDCUPPILQFYAJ-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 2-(2-methyl-5-phenoxy-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | LFDCUPPILQFYAJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)OC3=CC=CC=C3)CCN.Cl |
Computed by PubChem (NCBI)