CAS 2054023-15-1 is the registry number for 5-Amino-n-(tert-butyl)-4'-chloro-[1,1'-biphenyl]-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-N-tert-butyl-5-(4-chlorophenyl)benzamide (CAS 2054023-15-1) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: 3-amino-N-tert-butyl-5-(4-chlorophenyl)benzamide. InChIKey: DODCTPIODFDLIP-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 3-amino-N-tert-butyl-5-(4-chlorophenyl)benzamide |
| InChIKey | DODCTPIODFDLIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC(=CC(=C1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)