cas: 942069-51-4 — see every product listed under this CAS number, including other names
2-(5-Bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 942069-51-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A842125-1g |
| cas | 942069-51-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 832.06 Pln | |
| Ambeed | 100g | 2217.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A842125 |
2-(5-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 942069-51-4) is a chemical compound with the molecular formula C12H15BBrFO2 and a molecular weight of 300.96 g/mol. IUPAC name: 2-(5-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PTGJNHQCYVUKPZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrFO2 |
|---|---|
| Molecular weight | 300.96 g/mol |
| IUPAC name | 2-(5-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PTGJNHQCYVUKPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)