cas: 871239-58-6 — see every product listed under this CAS number, including other names
2-(5-Bromopyridin-2-yl)-2-methylpropanenitrile, 97%, 97% (CAS 871239-58-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115KPU-250mg |
| cas | 871239-58-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 822.80 Pln | |
| Chemat | 100mg | 83.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(5-bromo-2-pyridinyl)-2-methylpropanenitrile (CAS 871239-58-6) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 2-(5-bromo-2-pyridinyl)-2-methylpropanenitrile. InChIKey: LCFRTRIRICENNR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 2-(5-bromo-2-pyridinyl)-2-methylpropanenitrile |
| InChIKey | LCFRTRIRICENNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)