Products 861803-78-3

CAS 861803-78-3 is the registry number for 3-Bromo-1,5-dimethylindazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

3-bromo-1,5-dimethylindazole (CAS 861803-78-3) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 3-bromo-1,5-dimethylindazole. InChIKey: JYPWTFQBPNNMON-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrN2
Molecular weight225.08 g/mol
IUPAC name3-bromo-1,5-dimethylindazole
InChIKeyJYPWTFQBPNNMON-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)N(N=C2Br)C

Computed by PubChem (NCBI)