Products 1335054-56-2
CAS 1335054-56-2 appears in our catalog under these names: 3-Bromo-2,7-dimethylimidazo[1,2-a]pyridine, 95%, 3-Bromo-2,7-dimethylimidazo(1,2-a)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-bromo-2,7-dimethylimidazo[1,2-a]pyridine (CAS 1335054-56-2) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 3-bromo-2,7-dimethylimidazo[1,2-a]pyridine. InChIKey: MDTPDAWPCKKFHE-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 3-bromo-2,7-dimethylimidazo[1,2-a]pyridine |
| InChIKey | MDTPDAWPCKKFHE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N2C=C1)Br)C |
Computed by PubChem (NCBI)