CAS 1159511-78-0 appears in our catalog under these names: 4-bromo-1,6-dimethylindazole, 95%, 4-Bromo-1,6-dimethyl-1H-indazole, 97%, 97%, 4-Bromo-1,6-dimethyl-1H-indazole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg.
4-bromo-1,6-dimethylindazole (CAS 1159511-78-0) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 4-bromo-1,6-dimethylindazole. InChIKey: IRRYVOVYPSBYMW-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 4-bromo-1,6-dimethylindazole |
| InChIKey | IRRYVOVYPSBYMW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=NN2C)C(=C1)Br |
Computed by PubChem (NCBI)