cas: 196081-79-5 — see every product listed under this CAS number, including other names
2-(5-bromo-1H-indol-3-yl)acetamide, 98% (CAS 196081-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F370938-100MG |
| cas | 196081-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 1174.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(5-bromo-1H-indol-3-yl)acetamide (CAS 196081-79-5) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 2-(5-bromo-1H-indol-3-yl)acetamide. InChIKey: DVPBWLLOGOINDW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-(5-bromo-1H-indol-3-yl)acetamide |
| InChIKey | DVPBWLLOGOINDW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)CC(=O)N |
Computed by PubChem (NCBI)