cas: 953848-21-0 — see every product listed under this CAS number, including other names
2-(5-bromopyridin-3-yl)-1H-benzo[d]imidazole (CAS 953848-21-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DUDY-100mg |
| cas | 953848-21-0 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 500mg | 1926.80 Pln |
| delivery time | 3 weeks |
|---|
2-(5-bromo-3-pyridinyl)-1H-benzimidazole (CAS 953848-21-0) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 2-(5-bromo-3-pyridinyl)-1H-benzimidazole. InChIKey: JOVCWHSZOOXJPD-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-(5-bromo-3-pyridinyl)-1H-benzimidazole |
| InChIKey | JOVCWHSZOOXJPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC(=CN=C3)Br |
Computed by PubChem (NCBI)