CAS 1956322-03-4 is the registry number for 6-(3-Bromophenyl)imidazo[1,5-a]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(3-bromophenyl)imidazo[1,5-a]pyrimidine (CAS 1956322-03-4) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 6-(3-bromophenyl)imidazo[1,5-a]pyrimidine. InChIKey: GQWCPAKTVFWOTA-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 6-(3-bromophenyl)imidazo[1,5-a]pyrimidine |
| InChIKey | GQWCPAKTVFWOTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC=C3N2C=CC=N3 |
Computed by PubChem (NCBI)