CAS 54230-91-0 is the registry number for 8-Bromo-3-phenyl-[1,2,4]triazolo[4,3-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
8-bromo-3-phenyl-[1,2,4]triazolo[4,3-a]pyridine (CAS 54230-91-0) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 8-bromo-3-phenyl-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: TVHNHTMDQDNMPV-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 8-bromo-3-phenyl-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | TVHNHTMDQDNMPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C3N2C=CC=C3Br |
Computed by PubChem (NCBI)