CAS 1159815-57-2 appears in our catalog under these names: 6-Bromo-8-phenylimidazo[1,2-a]pyrazine, 95%, 6-Bromo-8-phenylimidazo[1,2-a]pyrazine, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg, 1g.
6-bromo-8-phenylimidazo[1,2-a]pyrazine (CAS 1159815-57-2) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 6-bromo-8-phenylimidazo[1,2-a]pyrazine. InChIKey: BTNPEXCLDJWMNJ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 6-bromo-8-phenylimidazo[1,2-a]pyrazine |
| InChIKey | BTNPEXCLDJWMNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CN3C2=NC=C3)Br |
Computed by PubChem (NCBI)