cas: 2221812-38-8 — see every product listed under this CAS number, including other names
2-(6-Bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane, ≥95%, ≥95% (CAS 2221812-38-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K75T-1g |
| cas | 2221812-38-8 |
| size | 1g |
| availability | 23g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1926.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(6-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane (CAS 2221812-38-8) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: 2-(6-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane. InChIKey: WEOZHUCEGDZWNE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 2-(6-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane |
| InChIKey | WEOZHUCEGDZWNE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C2OCCO2)F |
Computed by PubChem (NCBI)