CAS 125564-50-3 is the registry number for 2-(8-Oxo-5,6,7,8-tetrahydronaphthalen-2-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
2-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)acetic acid (CAS 125564-50-3) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 2-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)acetic acid. InChIKey: YKPMPPPPIFOHSF-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)acetic acid |
| InChIKey | YKPMPPPPIFOHSF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)CC(=O)O)C(=O)C1 |
Computed by PubChem (NCBI)