CAS 6500-63-6 is the registry number for (2E,4E)-5-(3-Methoxyphenyl)penta-2,4-dienoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2E,4E)-5-(3-methoxyphenyl)penta-2,4-dienoic acid (CAS 6500-63-6) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: (2E,4E)-5-(3-methoxyphenyl)penta-2,4-dienoic acid. InChIKey: XVWJWKYAUAINIZ-QKVOYMTASA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2E,4E)-5-(3-methoxyphenyl)penta-2,4-dienoic acid |
| InChIKey | XVWJWKYAUAINIZ-QKVOYMTASA-N |
| SMILES | COC1=CC=CC(=C1)/C=C/C=C/C(=O)O |
Computed by PubChem (NCBI)