CAS 53666-71-0 appears in our catalog under these names: 3-Ethyl-7-hydroxy-4-methyl-2h-chromen-2-one, 95%, 3-Ethyl-7-hydroxy-4-methyl-2H-chromen-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
3-ethyl-7-hydroxy-4-methylchromen-2-one (CAS 53666-71-0) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 3-ethyl-7-hydroxy-4-methylchromen-2-one. InChIKey: BKZKRVHQFPBHFH-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-ethyl-7-hydroxy-4-methylchromen-2-one |
| InChIKey | BKZKRVHQFPBHFH-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(C=C(C=C2)O)OC1=O)C |
Computed by PubChem (NCBI)