CAS 15254-22-5 appears in our catalog under these names: 4-(2,5-Dimethylphenyl)-4-oxobut-2-enoic acid, 95%, 3-(2,5-Dimethylbenzoyl)-acrylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid (CAS 15254-22-5) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid. InChIKey: YHCFVGCMSKTDFZ-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid |
| InChIKey | YHCFVGCMSKTDFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)C=CC(=O)O |
Computed by PubChem (NCBI)