cas: 2304633-93-8 — see every product listed under this CAS number, including other names
2-(Acetoxymethyl)-6-methylphenylboronic Acid Pinacol Ester, ≥95%, ≥95% (CAS 2304633-93-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch131ICU-1g |
| cas | 2304633-93-8 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2464.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate (CAS 2304633-93-8) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: [3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate. InChIKey: FTPUNPSIOIOENE-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | [3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
| InChIKey | FTPUNPSIOIOENE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2COC(=O)C)C |
Computed by PubChem (NCBI)