cas: 85069-60-9 — see every product listed under this CAS number, including other names
2-(BOC-AMINO)-3-BROMOTHIOPHENE, 98% (CAS 85069-60-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301922-250MG |
| cas | 85069-60-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1872.28 Pln | |
| Fluorochem | 10g | 3423.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(3-bromothiophen-2-yl)carbamate (CAS 85069-60-9) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: tert-butyl N-(3-bromothiophen-2-yl)carbamate. InChIKey: BHWDDKRHHBHKGQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | tert-butyl N-(3-bromothiophen-2-yl)carbamate |
| InChIKey | BHWDDKRHHBHKGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CS1)Br |
Computed by PubChem (NCBI)