tert-Butyl (3-bromothiophen-2-yl)carbamate, 97%
cas: 85069-60-9 — see every product listed under this CAS number, including other names
tert-Butyl (3-bromothiophen-2-yl)carbamate, 97% (CAS 85069-60-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A463380-250mg |
| cas | 85069-60-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 1894.50 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 342.13 Pln | |
| BLDpharm | 1g | 686.45 Pln | |
| BLDpharm | 5g | 2035.97 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 500mg | 366.80 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1437.20 Pln | |
| Chemat | 10g | 2694.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl N-(3-bromothiophen-2-yl)carbamate (CAS 85069-60-9) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: tert-butyl N-(3-bromothiophen-2-yl)carbamate. InChIKey: BHWDDKRHHBHKGQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | tert-butyl N-(3-bromothiophen-2-yl)carbamate |
| InChIKey | BHWDDKRHHBHKGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CS1)Br |
Computed by PubChem (NCBI)
