cas: 679392-20-2 — see every product listed under this CAS number, including other names
2-(BOC-AMINO)-6-CHLORO-3-METHYLPYRIDINE, 95% (CAS 679392-20-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472376-100MG |
| cas | 679392-20-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 721.64 Pln | |
| Fluorochem | 1g | 2044.09 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(6-chloro-3-methyl-2-pyridinyl)carbamate (CAS 679392-20-2) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: tert-butyl N-(6-chloro-3-methyl-2-pyridinyl)carbamate. InChIKey: XLKOZEMAPJGWBA-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | tert-butyl N-(6-chloro-3-methyl-2-pyridinyl)carbamate |
| InChIKey | XLKOZEMAPJGWBA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C=C1)Cl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)