CAS 1094033-66-5 appears in our catalog under these names: 4-(Piperazin-1-yl)benzoic acid, 95%, 4-(Piperazin-1-yl)benzoic acid hydrochloride, 95%, 4-(Piperazin-1-yl)benzoic acid hydrochloride, 4-(piperazin-1-yl)benzoic acid hydrochloride, 97%, 97%, 4-(Piperazin-1-yl)benzoic acid hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2g, 5g, 10g, 25g, 100mg.
4-piperazin-1-ylbenzoic acid;hydrochloride (CAS 1094033-66-5) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-piperazin-1-ylbenzoic acid;hydrochloride. InChIKey: SHGCPZZRYOCKIT-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-piperazin-1-ylbenzoic acid;hydrochloride |
| InChIKey | SHGCPZZRYOCKIT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)