CAS 1240527-44-9 appears in our catalog under these names: 3-[(Piperazin-1-yl)carbonyl]phenol hydrochloride, 95%, (3-Hydroxyphenyl)(piperazin-1-yl)methanone hcl, 98%, 3–(Piperazine–1–carbonyl)phenol hydrochloride, 3-(Piperazine-1-carbonyl)phenol hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
(3-hydroxyphenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1240527-44-9) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: (3-hydroxyphenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: SZDTYXXSKORDJP-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | (3-hydroxyphenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | SZDTYXXSKORDJP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=CC=C2)O.Cl |
Computed by PubChem (NCBI)