CAS 1196153-37-3 appears in our catalog under these names: tert-Butyl (5-(chloromethyl)pyridin-3-yl)carbamate, 95%, tert-Butyl (5-(chloromethyl)pyridin-3-yl)carbamate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl N-[5-(chloromethyl)-3-pyridinyl]carbamate (CAS 1196153-37-3) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: tert-butyl N-[5-(chloromethyl)-3-pyridinyl]carbamate. InChIKey: SGOBVBFJIZKLIW-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | tert-butyl N-[5-(chloromethyl)-3-pyridinyl]carbamate |
| InChIKey | SGOBVBFJIZKLIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=CC(=C1)CCl |
Computed by PubChem (NCBI)