CAS 376584-76-8 appears in our catalog under these names: Benzo(b)thiophene-2-boronic acid pinacol ester, 2-(Benzo[b]thiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(Benzo[b]thiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2-(Benzo[b]thiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g, 100g.
2-(1-benzothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 376584-76-8) is a chemical compound with the molecular formula C14H17BO2S and a molecular weight of 260.2 g/mol. IUPAC name: 2-(1-benzothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RQIATWFGYKTVCM-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2S |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(1-benzothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RQIATWFGYKTVCM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)