CAS 2225176-64-5 is the registry number for 3–(tert–Butyl)–5–(2–thienyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(3-tert-butyl-5-thiophen-2-ylphenyl)boronic acid (CAS 2225176-64-5) is a chemical compound with the molecular formula C14H17BO2S and a molecular weight of 260.2 g/mol. IUPAC name: (3-tert-butyl-5-thiophen-2-ylphenyl)boronic acid. InChIKey: IIGWTMJNRQUULQ-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2S |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | (3-tert-butyl-5-thiophen-2-ylphenyl)boronic acid |
| InChIKey | IIGWTMJNRQUULQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C2=CC=CS2)(O)O |
Computed by PubChem (NCBI)