CAS 171364-86-6 appears in our catalog under these names: 2-Benzo[b]thiophen-3-yl-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane, 98%, Benzo(b)thiophene–3–boronic acid pinacol ester, Benzo[b]thiophene-3-boronic acid pinacol ester, 95% , 2-(Benzo[b]thiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T), 2-(benzo(b)thiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 5g, 1g, 25g, 250mg, 0,5g, 10g.
2-(1-benzothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 171364-86-6) is a chemical compound with the molecular formula C14H17BO2S and a molecular weight of 260.2 g/mol. IUPAC name: 2-(1-benzothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LTSGSDOTQABJMA-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2S |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(1-benzothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LTSGSDOTQABJMA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC3=CC=CC=C23 |
Computed by PubChem (NCBI)