CAS 1000160-75-7 appears in our catalog under these names: Benzothiophene–4–boronic acid pinacol ester, Benzothiophene-4-boronic acid pinacol ester, 2-(Benzo[b]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene, 98%, 98%, 2-(Benzo[b]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 10g, 250mg, 5g, 25g.
2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1000160-75-7) is a chemical compound with the molecular formula C14H17BO2S and a molecular weight of 260.2 g/mol. IUPAC name: 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KQTHIDLDBILMSE-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2S |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KQTHIDLDBILMSE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CSC3=CC=C2 |
Computed by PubChem (NCBI)