CAS 915412-92-9 appears in our catalog under these names: 2-(Benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(Benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(Benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 250mg, 100mg, 1g.
2-(1-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 915412-92-9) is a chemical compound with the molecular formula C14H17BO3 and a molecular weight of 244.10 g/mol. IUPAC name: 2-(1-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QHBWRIRRPKKWSW-UHFFFAOYSA-N.
| Molecular formula | C14H17BO3 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 2-(1-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QHBWRIRRPKKWSW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=COC3=CC=C2 |
Computed by PubChem (NCBI)