CAS 1333411-87-2 appears in our catalog under these names: (6-(Sec-butoxy)naphthalen-2-yl)boronic acid, 6-(sec-butoxy)naphthalen-2-yl]boronic acid, 95%, 4-Methyl-8-(o-tolyl)dihydro-4l4,8l4-(1,3,2)oxazaborolo(2,3-b)(1,3,2)oxazaborole-2,6(3H,5H)-dione, 98%, (6-(Sec-butoxy)naphthalen-2-yl)boronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
(6-butan-2-yloxynaphthalen-2-yl)boronic acid (CAS 1333411-87-2) is a chemical compound with the molecular formula C14H17BO3 and a molecular weight of 244.10 g/mol. IUPAC name: (6-butan-2-yloxynaphthalen-2-yl)boronic acid. InChIKey: YPRMAPNMEHYHRP-UHFFFAOYSA-N.
| Molecular formula | C14H17BO3 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | (6-butan-2-yloxynaphthalen-2-yl)boronic acid |
| InChIKey | YPRMAPNMEHYHRP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)OC(C)CC)(O)O |
Computed by PubChem (NCBI)