CAS 402503-13-3 appears in our catalog under these names: 2-(Benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(Benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2-(1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 402503-13-3) is a chemical compound with the molecular formula C14H17BO3 and a molecular weight of 244.10 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GVWNFCUCNAWDNO-UHFFFAOYSA-N.
| Molecular formula | C14H17BO3 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GVWNFCUCNAWDNO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)