Products 2225169-55-9
CAS 2225169-55-9 is the registry number for 3–(tert–Butyl)–5–(3–furyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3-tert-butyl-5-(furan-3-yl)phenyl]boronic acid (CAS 2225169-55-9) is a chemical compound with the molecular formula C14H17BO3 and a molecular weight of 244.10 g/mol. IUPAC name: [3-tert-butyl-5-(furan-3-yl)phenyl]boronic acid. InChIKey: RQYDVJNAUCCSIT-UHFFFAOYSA-N.
| Molecular formula | C14H17BO3 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | [3-tert-butyl-5-(furan-3-yl)phenyl]boronic acid |
| InChIKey | RQYDVJNAUCCSIT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C2=COC=C2)(O)O |
Computed by PubChem (NCBI)