cas: 688363-79-3 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-1-bromo-3-nitrobenzene 98% (CAS 688363-79-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352855-10g |
| cas | 688363-79-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 236.88 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 1983.50 Pln | |
| Ambeed | 1000g | 3079.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A352855 |
1-bromo-3-nitro-2-phenylmethoxybenzene (CAS 688363-79-3) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 1-bromo-3-nitro-2-phenylmethoxybenzene. InChIKey: IJAMXMAVDDCHHD-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 1-bromo-3-nitro-2-phenylmethoxybenzene |
| InChIKey | IJAMXMAVDDCHHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)