cas: 688363-79-3 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-1-bromo-3-nitrobenzene, 98%, 98% (CAS 688363-79-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBVI-10g |
| cas | 688363-79-3 |
| size | 10g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 500g | 1689.60 Pln | |
| Chemat | 1kg | 2762.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-nitro-2-phenylmethoxybenzene (CAS 688363-79-3) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 1-bromo-3-nitro-2-phenylmethoxybenzene. InChIKey: IJAMXMAVDDCHHD-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 1-bromo-3-nitro-2-phenylmethoxybenzene |
| InChIKey | IJAMXMAVDDCHHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)