cas: 23806-76-0 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-3-methoxybenzoic acid, 97%, 97% (CAS 23806-76-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5LW-250mg |
| cas | 23806-76-0 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 597.20 Pln | |
| Chemat | 5g | 1970.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-2-phenylmethoxybenzoic acid (CAS 23806-76-0) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-methoxy-2-phenylmethoxybenzoic acid. InChIKey: YLYLDKOXGOLUGR-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-methoxy-2-phenylmethoxybenzoic acid |
| InChIKey | YLYLDKOXGOLUGR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)