Products 375351-99-8

CAS 375351-99-8 is the registry number for 5-[(2,3-Dihydro-1h-inden-5-yloxy)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxylic acid (CAS 375351-99-8) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxylic acid. InChIKey: BQKLXOGKDTYPRT-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O4
Molecular weight258.27 g/mol
IUPAC name5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxylic acid
InChIKeyBQKLXOGKDTYPRT-UHFFFAOYSA-N
SMILESC1CC2=C(C1)C=C(C=C2)OCC3=CC=C(O3)C(=O)O

Computed by PubChem (NCBI)