CAS 375351-99-8 is the registry number for 5-[(2,3-Dihydro-1h-inden-5-yloxy)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxylic acid (CAS 375351-99-8) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxylic acid. InChIKey: BQKLXOGKDTYPRT-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxylic acid |
| InChIKey | BQKLXOGKDTYPRT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)OCC3=CC=C(O3)C(=O)O |
Computed by PubChem (NCBI)