CAS 41351-30-8 appears in our catalog under these names: 2,4-Dimethoxy-4'-hydroxybenzophenone, 98%, 2,4-Dimethoxy-4'-hydroxybenzophenone, 2,4-Dimethoxy-4'-hydroxybenzophenone, >98.0%(T), (2,4-Dimethoxyphenyl)(4-hydroxyphenyl)methanone, 99%, 99%, (2,4-Dimethoxyphenyl)(4-hydroxyphenyl)methanone, 98%. Offered by: Combi-blocks, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 50g, 250g, 500g, 10g.
(2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone (CAS 41351-30-8) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: (2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: QEHRETCJMLQPCR-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | QEHRETCJMLQPCR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)