cas: 51290-77-8 — see every product listed under this CAS number, including other names
2-(Benzylthio)-1H-benzo[d]imidazole, 97% (CAS 51290-77-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A539371-250mg |
| cas | 51290-77-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 1927.88 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 779.60 Pln | |
| Chemat | 5g | 2550.80 Pln | |
| BLDpharm | 250mg | 319.91 Pln | |
| BLDpharm | 1g | 686.45 Pln | |
| BLDpharm | 5g | 2074.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-benzylsulfanyl-1H-benzimidazole (CAS 51290-77-8) is a chemical compound with the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. IUPAC name: 2-benzylsulfanyl-1H-benzimidazole. InChIKey: IJINDUSMSVDESS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S |
|---|---|
| Molecular weight | 240.33 g/mol |
| IUPAC name | 2-benzylsulfanyl-1H-benzimidazole |
| InChIKey | IJINDUSMSVDESS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)