CAS 107411-05-2 appears in our catalog under these names: 5-Methyl-4-(naphthalen-1-yl)-1,3-thiazol-2-amine, 95%, 5-Methyl-4-(naphthalen-1-yl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-methyl-4-naphthalen-1-yl-1,3-thiazol-2-amine (CAS 107411-05-2) is a chemical compound with the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. IUPAC name: 5-methyl-4-naphthalen-1-yl-1,3-thiazol-2-amine. InChIKey: WOXJGUKYQNONEE-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S |
|---|---|
| Molecular weight | 240.33 g/mol |
| IUPAC name | 5-methyl-4-naphthalen-1-yl-1,3-thiazol-2-amine |
| InChIKey | WOXJGUKYQNONEE-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)