CAS 27174-03-4 is the registry number for (4-Isothiocyanatophenyl)(3-methylphenyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
N-(4-isothiocyanatophenyl)-3-methylaniline (CAS 27174-03-4) is a chemical compound with the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. IUPAC name: N-(4-isothiocyanatophenyl)-3-methylaniline. InChIKey: IKNZSUFASUBAOW-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S |
|---|---|
| Molecular weight | 240.33 g/mol |
| IUPAC name | N-(4-isothiocyanatophenyl)-3-methylaniline |
| InChIKey | IKNZSUFASUBAOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)