CAS 1239739-41-3 is the registry number for 4-(4-Methylbenzo[d]thiazol-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-methyl-1,3-benzothiazol-2-yl)aniline (CAS 1239739-41-3) is a chemical compound with the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. IUPAC name: 4-(4-methyl-1,3-benzothiazol-2-yl)aniline. InChIKey: SLXLJJZGTDCMJV-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S |
|---|---|
| Molecular weight | 240.33 g/mol |
| IUPAC name | 4-(4-methyl-1,3-benzothiazol-2-yl)aniline |
| InChIKey | SLXLJJZGTDCMJV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)SC(=N2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)